C18H21N3O3 — CID 11923494
2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-cyanophenoxy)acetyl]acetohydrazide (PubChem CID 11923494) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-cyanophenoxy)acetyl]acetohydrazide.
| Compound Name | 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-cyanophenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 11923494 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-cyanophenoxy)acetyl]acetohydrazide |
| SMILES | N#Cc1ccccc1OCC(=O)NNC(=O)C[C@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C18H21N3O3/c19-10-14-3-1-2-4-16(14)24-11-18(23)21-20-17(22)9-15-8-12-5-6-13(15)7-12/h1-4,12-13,15H,5-9,11H2,(H,20,22)(H,21,23)/t12-,13+,15+/m0/s1 |
| InChIKey | SOHNYJWVOIGAJB-GZBFAFLISA-N |
| XLogP | 1.91 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|