C17H23NO3 — CID 78843390
N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-(2-hydroxyphenoxy)acetamide (PubChem CID 78843390) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-(2-hydroxyphenoxy)acetamide.
| Compound Name | N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-(2-hydroxyphenoxy)acetamide |
|---|---|
| PubChem CID | 78843390 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[2-(2-bicyclo[2.2.1]heptanyl)ethyl]-2-(2-hydroxyphenoxy)acetamide |
| SMILES | O=C(COc1ccccc1O)NCCC1CC2CCC1C2 |
| InChI | InChI=1S/C17H23NO3/c19-15-3-1-2-4-16(15)21-11-17(20)18-8-7-14-10-12-5-6-13(14)9-12/h1-4,12-14,19H,5-11H2,(H,18,20) |
| InChIKey | MZHBAXDBNXNDOZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |