C12H17NO4 — CID 106843375
N-(4-hydroxybutyl)-2-(2-hydroxyphenoxy)acetamide (PubChem CID 106843375) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-2-(2-hydroxyphenoxy)acetamide.
| Compound Name | N-(4-hydroxybutyl)-2-(2-hydroxyphenoxy)acetamide |
|---|---|
| PubChem CID | 106843375 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-(4-hydroxybutyl)-2-(2-hydroxyphenoxy)acetamide |
| SMILES | O=C(COc1ccccc1O)NCCCCO |
| InChI | InChI=1S/C12H17NO4/c14-8-4-3-7-13-12(16)9-17-11-6-2-1-5-10(11)15/h1-2,5-6,14-15H,3-4,7-9H2,(H,13,16) |
| InChIKey | PLFPLMRGYPLFFI-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|