C12H16N2O5 — CID 106843022
N-(4-hydroxybutyl)-2-(2-nitrophenoxy)acetamide (PubChem CID 106843022) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-(4-hydroxybutyl)-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 106843022 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | N-(4-hydroxybutyl)-2-(2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])NCCCCO |
| InChI | InChI=1S/C12H16N2O5/c15-8-4-3-7-13-12(16)9-19-11-6-2-1-5-10(11)14(17)18/h1-2,5-6,15H,3-4,7-9H2,(H,13,16) |
| InChIKey | WXRPVSXYUINLDW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|