C17H24N2O5 — CID 51222276
N-(3-cyclohexyloxypropyl)-2-(2-nitrophenoxy)acetamide (PubChem CID 51222276) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 51222276 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-(2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])NCCCOC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O5/c20-17(13-24-16-10-5-4-9-15(16)19(21)22)18-11-6-12-23-14-7-2-1-3-8-14/h4-5,9-10,14H,1-3,6-8,11-13H2,(H,18,20) |
| InChIKey | KFKVODUBEXAHFN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|