C19H28N2O4 — CID 40659124
N-(3-cyclohexyloxypropyl)-2-[(2-phenoxyacetyl)amino]acetamide (PubChem CID 40659124) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is N-(3-cyclohexyloxypropyl)-2-[(2-phenoxyacetyl)amino]acetamide.
| Compound Name | N-(3-cyclohexyloxypropyl)-2-[(2-phenoxyacetyl)amino]acetamide |
|---|---|
| PubChem CID | 40659124 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-(3-cyclohexyloxypropyl)-2-[(2-phenoxyacetyl)amino]acetamide |
| SMILES | O=C(CNC(=O)COc1ccccc1)NCCCOC1CCCCC1 |
| InChI | InChI=1S/C19H28N2O4/c22-18(20-12-7-13-24-16-8-3-1-4-9-16)14-21-19(23)15-25-17-10-5-2-6-11-17/h2,5-6,10-11,16H,1,3-4,7-9,12-15H2,(H,20,22)(H,21,23) |
| InChIKey | QLJAUURSWDDETC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|