C18H25N3O5 — CID 34060563
4-cyclohexyl-N'-[2-(2-nitrophenoxy)acetyl]butanehydrazide (PubChem CID 34060563) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is 4-cyclohexyl-N'-[2-(2-nitrophenoxy)acetyl]butanehydrazide.
| Compound Name | 4-cyclohexyl-N'-[2-(2-nitrophenoxy)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 34060563 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-cyclohexyl-N'-[2-(2-nitrophenoxy)acetyl]butanehydrazide |
| SMILES | O=C(CCCC1CCCCC1)NNC(=O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N3O5/c22-17(12-6-9-14-7-2-1-3-8-14)19-20-18(23)13-26-16-11-5-4-10-15(16)21(24)25/h4-5,10-11,14H,1-3,6-9,12-13H2,(H,19,22)(H,20,23) |
| InChIKey | MNHIJFZHTYPEGO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|