C19H23N3O5 — CID 8800431
N'-[2-(2-nitrophenoxy)acetyl]adamantane-1-carbohydrazide (PubChem CID 8800431) has the molecular formula C19H23N3O5 and a molecular weight of 373.41 g/mol. Its IUPAC name is N'-[2-(2-nitrophenoxy)acetyl]adamantane-1-carbohydrazide.
| Compound Name | N'-[2-(2-nitrophenoxy)acetyl]adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 8800431 |
| Molecular Formula | C19H23N3O5 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N'-[2-(2-nitrophenoxy)acetyl]adamantane-1-carbohydrazide |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H23N3O5/c23-17(11-27-16-4-2-1-3-15(16)22(25)26)20-21-18(24)19-8-12-5-13(9-19)7-14(6-12)10-19/h1-4,12-14H,5-11H2,(H,20,23)(H,21,24) |
| InChIKey | MEMFUTJTDDVBRU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|