C13H17F2NO3 — CID 107318520
2-(2,4-difluorophenoxy)-N-(5-hydroxypentyl)acetamide (PubChem CID 107318520) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-(5-hydroxypentyl)acetamide.
| Compound Name | 2-(2,4-difluorophenoxy)-N-(5-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 107318520 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-(5-hydroxypentyl)acetamide |
| SMILES | O=C(COc1ccc(F)cc1F)NCCCCCO |
| InChI | InChI=1S/C13H17F2NO3/c14-10-4-5-12(11(15)8-10)19-9-13(18)16-6-2-1-3-7-17/h4-5,8,17H,1-3,6-7,9H2,(H,16,18) |
| InChIKey | GIWHDBBYHOIWPX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|