C14H17F2NO4 — CID 104682587
5-[[2-(2,4-difluorophenoxy)acetyl]amino]-2-methylpentanoic acid (PubChem CID 104682587) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is 5-[[2-(2,4-difluorophenoxy)acetyl]amino]-2-methylpentanoic acid.
| Compound Name | 5-[[2-(2,4-difluorophenoxy)acetyl]amino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 104682587 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 5-[[2-(2,4-difluorophenoxy)acetyl]amino]-2-methylpentanoic acid |
| SMILES | CC(CCCNC(=O)COc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C14H17F2NO4/c1-9(14(19)20)3-2-6-17-13(18)8-21-12-5-4-10(15)7-11(12)16/h4-5,7,9H,2-3,6,8H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | DKOOXVLQIIRIME-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|