C16H23F2NO3 — CID 111485139
2-(2,4-difluorophenoxy)-N-(2-hydroxy-2,5-dimethylhexyl)acetamide (PubChem CID 111485139) has the molecular formula C16H23F2NO3 and a molecular weight of 315.36 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-(2-hydroxy-2,5-dimethylhexyl)acetamide.
| Compound Name | 2-(2,4-difluorophenoxy)-N-(2-hydroxy-2,5-dimethylhexyl)acetamide |
|---|---|
| PubChem CID | 111485139 |
| Molecular Formula | C16H23F2NO3 |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-(2-hydroxy-2,5-dimethylhexyl)acetamide |
| SMILES | CC(C)CCC(C)(O)CNC(=O)COc1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2NO3/c1-11(2)6-7-16(3,21)10-19-15(20)9-22-14-5-4-12(17)8-13(14)18/h4-5,8,11,21H,6-7,9-10H2,1-3H3,(H,19,20) |
| InChIKey | UNJUCXJGQOZQAV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |