C14H17F2NO4 — CID 78975765
(2R)-2-[[2-(2,4-difluorophenoxy)acetyl]amino]-4-methylpentanoic acid (PubChem CID 78975765) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is (2R)-2-[[2-(2,4-difluorophenoxy)acetyl]amino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[[2-(2,4-difluorophenoxy)acetyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78975765 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (2R)-2-[[2-(2,4-difluorophenoxy)acetyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NC(=O)COc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C14H17F2NO4/c1-8(2)5-11(14(19)20)17-13(18)7-21-12-4-3-9(15)6-10(12)16/h3-4,6,8,11H,5,7H2,1-2H3,(H,17,18)(H,19,20)/t11-/m1/s1 |
| InChIKey | GLYJHYRDDHQDND-LLVKDONJSA-N |
| XLogP | 1.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |