C13H15F2NO4 — CID 64672095
3-[[2-(2,4-difluorophenoxy)acetyl]amino]-3-methylbutanoic acid (PubChem CID 64672095) has the molecular formula C13H15F2NO4 and a molecular weight of 287.26 g/mol. Its IUPAC name is 3-[[2-(2,4-difluorophenoxy)acetyl]amino]-3-methylbutanoic acid.
| Compound Name | 3-[[2-(2,4-difluorophenoxy)acetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 64672095 |
| Molecular Formula | C13H15F2NO4 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3-[[2-(2,4-difluorophenoxy)acetyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)(CC(=O)O)NC(=O)COc1ccc(F)cc1F |
| InChI | InChI=1S/C13H15F2NO4/c1-13(2,6-12(18)19)16-11(17)7-20-10-4-3-8(14)5-9(10)15/h3-5H,6-7H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | HEHMVTYUFZZCHP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |