C14H17F2NO4 — CID 119187526
2-[4-(2,4-difluorophenoxy)butanoylamino]-2-methylpropanoic acid (PubChem CID 119187526) has the molecular formula C14H17F2NO4 and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-[4-(2,4-difluorophenoxy)butanoylamino]-2-methylpropanoic acid.
| Compound Name | 2-[4-(2,4-difluorophenoxy)butanoylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119187526 |
| Molecular Formula | C14H17F2NO4 |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[4-(2,4-difluorophenoxy)butanoylamino]-2-methylpropanoic acid |
| SMILES | CC(C)(NC(=O)CCCOc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C14H17F2NO4/c1-14(2,13(19)20)17-12(18)4-3-7-21-11-6-5-9(15)8-10(11)16/h5-6,8H,3-4,7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | LLHZIGDEDRPTNE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|