2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid

C14H17F2NO3 — CID 120515884

IUPAC2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid
SMILESCC(CC(=O)NC(C)(C)C(=O)O)c1ccc(F)cc1F
InChIInChI=1S/C14H17F2NO3/c1-8(10-5-4-9(15)7-11(10)16)6-12(18)17-14(2,3)13(19)20/h4-5,7-8H,6H2,1-3H3,(H,17,18)(H,19,20)
InChIKeyIQBVVWLLEWHQTC-UHFFFAOYSA-N
MW285.29 g/mol
LogP2.44
Rot. Bonds5

About 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid

2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid (PubChem CID 120515884) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid.

Molecular Properties

Compound Name2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid
PubChem CID120515884
Molecular FormulaC14H17F2NO3
Molecular Weight285.29 g/mol
Exact Mass285.12
IUPAC Name2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid
SMILESCC(CC(=O)NC(C)(C)C(=O)O)c1ccc(F)cc1F
InChIInChI=1S/C14H17F2NO3/c1-8(10-5-4-9(15)7-11(10)16)6-12(18)17-14(2,3)13(19)20/h4-5,7-8H,6H2,1-3H3,(H,17,18)(H,19,20)
InChIKeyIQBVVWLLEWHQTC-UHFFFAOYSA-N
XLogP2.44
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.29
LogP ≤ 52.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid?
The IUPAC name of 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid (CID 120515884) is 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid.
What is the SMILES notation for 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid?
The canonical SMILES for 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid is CC(CC(=O)NC(C)(C)C(=O)O)c1ccc(F)cc1F.
What is the InChIKey of 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid?
The InChIKey is IQBVVWLLEWHQTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17F2NO3/c1-8(10-5-4-9(15)7-11(10)16)6-12(18)17-14(2,3)13(19)20/h4-5,7-8H,6H2,1-3H3,(H,17,18)(H,19,20).
What are the key properties of 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid?
2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid has a molecular weight of 285.29 g/mol, XLogP of 2.44, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpropanoic acid is sourced from PubChem (CID 120515884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).