C16H21F2NO3 — CID 120516951
2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpentanoic acid (PubChem CID 120516951) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpentanoic acid.
| Compound Name | 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 120516951 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-[3-(2,4-difluorophenyl)butanoylamino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C16H21F2NO3/c1-4-7-16(3,15(21)22)19-14(20)8-10(2)12-6-5-11(17)9-13(12)18/h5-6,9-10H,4,7-8H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | RCNXNLUWWBMFRP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |