2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid

C16H21F2NO3 — CID 120537901

IUPAC2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid
SMILESCCCCC(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O
InChIInChI=1S/C16H21F2NO3/c1-3-4-5-14(16(21)22)19-15(20)8-10(2)12-7-6-11(17)9-13(12)18/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,19,20)(H,21,22)
InChIKeyNSINZRQXOKFLLY-UHFFFAOYSA-N
MW313.34 g/mol
LogP3.22
Rot. Bonds8

About 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid

2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid (PubChem CID 120537901) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid.

Molecular Properties

Compound Name2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid
PubChem CID120537901
Molecular FormulaC16H21F2NO3
Molecular Weight313.34 g/mol
Exact Mass313.15
IUPAC Name2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid
SMILESCCCCC(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O
InChIInChI=1S/C16H21F2NO3/c1-3-4-5-14(16(21)22)19-15(20)8-10(2)12-7-6-11(17)9-13(12)18/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,19,20)(H,21,22)
InChIKeyNSINZRQXOKFLLY-UHFFFAOYSA-N
XLogP3.22
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500313.34
LogP ≤ 53.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid?
The IUPAC name of 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid (CID 120537901) is 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid.
What is the SMILES notation for 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid?
The canonical SMILES for 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid is CCCCC(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O.
What is the InChIKey of 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid?
The InChIKey is NSINZRQXOKFLLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F2NO3/c1-3-4-5-14(16(21)22)19-15(20)8-10(2)12-7-6-11(17)9-13(12)18/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,19,20)(H,21,22).
What are the key properties of 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid?
2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid has a molecular weight of 313.34 g/mol, XLogP of 3.22, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid is sourced from PubChem (CID 120537901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).