C16H21F2NO3 — CID 120537901
2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid (PubChem CID 120537901) has the molecular formula C16H21F2NO3 and a molecular weight of 313.34 g/mol. Its IUPAC name is 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid.
| Compound Name | 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 120537901 |
| Molecular Formula | C16H21F2NO3 |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 2-[3-(2,4-difluorophenyl)butanoylamino]hexanoic acid |
| SMILES | CCCCC(NC(=O)CC(C)c1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C16H21F2NO3/c1-3-4-5-14(16(21)22)19-15(20)8-10(2)12-7-6-11(17)9-13(12)18/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | NSINZRQXOKFLLY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |