C16H23F2NO2 — CID 122044654
(2S)-2-[4-(2,4-difluorophenyl)butan-2-ylamino]hexanoic acid (PubChem CID 122044654) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is (2S)-2-[4-(2,4-difluorophenyl)butan-2-ylamino]hexanoic acid.
| Compound Name | (2S)-2-[4-(2,4-difluorophenyl)butan-2-ylamino]hexanoic acid |
|---|---|
| PubChem CID | 122044654 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (2S)-2-[4-(2,4-difluorophenyl)butan-2-ylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(C)CCc1ccc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C16H23F2NO2/c1-3-4-5-15(16(20)21)19-11(2)6-7-12-8-9-13(17)10-14(12)18/h8-11,15,19H,3-7H2,1-2H3,(H,20,21)/t11?,15-/m0/s1 |
| InChIKey | IEXLSVWMGGLSRO-MHTVFEQDSA-N |
| XLogP | 3.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |