C18H19F2NO2 — CID 122036055
4-[[4-(2,4-difluorophenyl)butan-2-ylamino]methyl]benzoic acid (PubChem CID 122036055) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is 4-[[4-(2,4-difluorophenyl)butan-2-ylamino]methyl]benzoic acid.
| Compound Name | 4-[[4-(2,4-difluorophenyl)butan-2-ylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122036055 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 4-[[4-(2,4-difluorophenyl)butan-2-ylamino]methyl]benzoic acid |
| SMILES | CC(CCc1ccc(F)cc1F)NCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C18H19F2NO2/c1-12(2-5-14-8-9-16(19)10-17(14)20)21-11-13-3-6-15(7-4-13)18(22)23/h3-4,6-10,12,21H,2,5,11H2,1H3,(H,22,23) |
| InChIKey | NFXOVXSCJWPKCH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |