C17H19F2N3O — CID 173160059
5-[3-[(2,4-difluorophenyl)methylamino]butyl]pyridine-3-carboxamide (PubChem CID 173160059) has the molecular formula C17H19F2N3O and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-[3-[(2,4-difluorophenyl)methylamino]butyl]pyridine-3-carboxamide.
| Compound Name | 5-[3-[(2,4-difluorophenyl)methylamino]butyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 173160059 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 5-[3-[(2,4-difluorophenyl)methylamino]butyl]pyridine-3-carboxamide |
| SMILES | CC(CCc1cncc(C(N)=O)c1)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C17H19F2N3O/c1-11(22-10-13-4-5-15(18)7-16(13)19)2-3-12-6-14(17(20)23)9-21-8-12/h4-9,11,22H,2-3,10H2,1H3,(H2,20,23) |
| InChIKey | PGLXIWQNHZBAME-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |