C11H13F2N3O2 — CID 55037642
N-carbamoyl-2-[(2,4-difluorophenyl)methylamino]propanamide (PubChem CID 55037642) has the molecular formula C11H13F2N3O2 and a molecular weight of 257.24 g/mol. Its IUPAC name is N-carbamoyl-2-[(2,4-difluorophenyl)methylamino]propanamide.
| Compound Name | N-carbamoyl-2-[(2,4-difluorophenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 55037642 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-carbamoyl-2-[(2,4-difluorophenyl)methylamino]propanamide |
| SMILES | CC(NCc1ccc(F)cc1F)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H13F2N3O2/c1-6(10(17)16-11(14)18)15-5-7-2-3-8(12)4-9(7)13/h2-4,6,15H,5H2,1H3,(H3,14,16,17,18) |
| InChIKey | MEAMKAPFFVWYCR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |