C11H11ClF2N2O2 — CID 62228150
2-chloro-N-[(2,4-difluorophenyl)methylcarbamoyl]propanamide (PubChem CID 62228150) has the molecular formula C11H11ClF2N2O2 and a molecular weight of 276.67 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-difluorophenyl)methylcarbamoyl]propanamide.
| Compound Name | 2-chloro-N-[(2,4-difluorophenyl)methylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 62228150 |
| Molecular Formula | C11H11ClF2N2O2 |
| Molecular Weight | 276.67 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-chloro-N-[(2,4-difluorophenyl)methylcarbamoyl]propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C11H11ClF2N2O2/c1-6(12)10(17)16-11(18)15-5-7-2-3-8(13)4-9(7)14/h2-4,6H,5H2,1H3,(H2,15,16,17,18) |
| InChIKey | PBXROPXIUQUKJH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.67 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|