C17H24ClF2NO — CID 91576928
2-chloro-N-[(2,4-difluorophenyl)methyl]decanamide (PubChem CID 91576928) has the molecular formula C17H24ClF2NO and a molecular weight of 331.83 g/mol. Its IUPAC name is 2-chloro-N-[(2,4-difluorophenyl)methyl]decanamide.
| Compound Name | 2-chloro-N-[(2,4-difluorophenyl)methyl]decanamide |
|---|---|
| PubChem CID | 91576928 |
| Molecular Formula | C17H24ClF2NO |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-chloro-N-[(2,4-difluorophenyl)methyl]decanamide |
| SMILES | CCCCCCCCC(Cl)C(=O)NCc1ccc(F)cc1F |
| InChI | InChI=1S/C17H24ClF2NO/c1-2-3-4-5-6-7-8-15(18)17(22)21-12-13-9-10-14(19)11-16(13)20/h9-11,15H,2-8,12H2,1H3,(H,21,22) |
| InChIKey | NAHQSXUJJYOPSG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|