C16H24F2O — CID 64559073
1-(2,4-difluorophenyl)decan-2-ol (PubChem CID 64559073) has the molecular formula C16H24F2O and a molecular weight of 270.36 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)decan-2-ol.
| Compound Name | 1-(2,4-difluorophenyl)decan-2-ol |
|---|---|
| PubChem CID | 64559073 |
| Molecular Formula | C16H24F2O |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 1-(2,4-difluorophenyl)decan-2-ol |
| SMILES | CCCCCCCCC(O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C16H24F2O/c1-2-3-4-5-6-7-8-15(19)11-13-9-10-14(17)12-16(13)18/h9-10,12,15,19H,2-8,11H2,1H3 |
| InChIKey | GRLNGTARHANAFS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|