C11H14ClFO — CID 62607073
1-(2-chloro-4-fluorophenyl)pentan-2-ol (PubChem CID 62607073) has the molecular formula C11H14ClFO and a molecular weight of 216.68 g/mol. Its IUPAC name is 1-(2-chloro-4-fluorophenyl)pentan-2-ol.
| Compound Name | 1-(2-chloro-4-fluorophenyl)pentan-2-ol |
|---|---|
| PubChem CID | 62607073 |
| Molecular Formula | C11H14ClFO |
| Molecular Weight | 216.68 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 1-(2-chloro-4-fluorophenyl)pentan-2-ol |
| SMILES | CCCC(O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H14ClFO/c1-2-3-10(14)6-8-4-5-9(13)7-11(8)12/h4-5,7,10,14H,2-3,6H2,1H3 |
| InChIKey | OKFKZMNCFDMMOA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.68 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |