C13H18ClFOS — CID 65132928
1-tert-butylsulfanyl-3-(2-chloro-4-fluorophenyl)propan-2-ol (PubChem CID 65132928) has the molecular formula C13H18ClFOS and a molecular weight of 276.80 g/mol. Its IUPAC name is 1-tert-butylsulfanyl-3-(2-chloro-4-fluorophenyl)propan-2-ol.
| Compound Name | 1-tert-butylsulfanyl-3-(2-chloro-4-fluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 65132928 |
| Molecular Formula | C13H18ClFOS |
| Molecular Weight | 276.80 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-tert-butylsulfanyl-3-(2-chloro-4-fluorophenyl)propan-2-ol |
| SMILES | CC(C)(C)SCC(O)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C13H18ClFOS/c1-13(2,3)17-8-11(16)6-9-4-5-10(15)7-12(9)14/h4-5,7,11,16H,6,8H2,1-3H3 |
| InChIKey | WUUJTWKAFPJMHE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.80 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |