C15H22F2O — CID 63902016
1-(2,4-difluorophenyl)nonan-2-ol (PubChem CID 63902016) has the molecular formula C15H22F2O and a molecular weight of 256.34 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)nonan-2-ol.
| Compound Name | 1-(2,4-difluorophenyl)nonan-2-ol |
|---|---|
| PubChem CID | 63902016 |
| Molecular Formula | C15H22F2O |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-(2,4-difluorophenyl)nonan-2-ol |
| SMILES | CCCCCCCC(O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H22F2O/c1-2-3-4-5-6-7-14(18)10-12-8-9-13(16)11-15(12)17/h8-9,11,14,18H,2-7,10H2,1H3 |
| InChIKey | ZNLLVUNOFXKINJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|