C11H14F2 — CID 20770613
2,4-difluoro-1-pentylbenzene (PubChem CID 20770613) has the molecular formula C11H14F2 and a molecular weight of 184.23 g/mol. Its IUPAC name is 2,4-difluoro-1-pentylbenzene.
| Compound Name | 2,4-difluoro-1-pentylbenzene |
|---|---|
| PubChem CID | 20770613 |
| Molecular Formula | C11H14F2 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2,4-difluoro-1-pentylbenzene |
| SMILES | CCCCCc1ccc(F)cc1F |
| InChI | InChI=1S/C11H14F2/c1-2-3-4-5-9-6-7-10(12)8-11(9)13/h6-8H,2-5H2,1H3 |
| InChIKey | LWNQTRAECPFBAF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|