C16H26F2O2Si — CID 90173469
5-(2,4-difluorophenyl)pentyl-diethoxy-methylsilane (PubChem CID 90173469) has the molecular formula C16H26F2O2Si and a molecular weight of 316.46 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)pentyl-diethoxy-methylsilane.
| Compound Name | 5-(2,4-difluorophenyl)pentyl-diethoxy-methylsilane |
|---|---|
| PubChem CID | 90173469 |
| Molecular Formula | C16H26F2O2Si |
| Molecular Weight | 316.46 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 5-(2,4-difluorophenyl)pentyl-diethoxy-methylsilane |
| SMILES | CCO[Si](C)(CCCCCc1ccc(F)cc1F)OCC |
| InChI | InChI=1S/C16H26F2O2Si/c1-4-19-21(3,20-5-2)12-8-6-7-9-14-10-11-15(17)13-16(14)18/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | ZLRDJYXLUSDELI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.46 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|