C14H22F2O3Si — CID 90175118
4-(2,4-difluorophenyl)butyl-diethoxy-hydroxysilane (PubChem CID 90175118) has the molecular formula C14H22F2O3Si and a molecular weight of 304.41 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)butyl-diethoxy-hydroxysilane.
| Compound Name | 4-(2,4-difluorophenyl)butyl-diethoxy-hydroxysilane |
|---|---|
| PubChem CID | 90175118 |
| Molecular Formula | C14H22F2O3Si |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-(2,4-difluorophenyl)butyl-diethoxy-hydroxysilane |
| SMILES | CCO[Si](O)(CCCCc1ccc(F)cc1F)OCC |
| InChI | InChI=1S/C14H22F2O3Si/c1-3-18-20(17,19-4-2)10-6-5-7-12-8-9-13(15)11-14(12)16/h8-9,11,17H,3-7,10H2,1-2H3 |
| InChIKey | YVQUTKAHCKCCMJ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|