C9H12F2O3Si — CID 90170768
2-(2,4-difluorophenyl)ethyl-dihydroxy-methoxysilane (PubChem CID 90170768) has the molecular formula C9H12F2O3Si and a molecular weight of 234.27 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)ethyl-dihydroxy-methoxysilane.
| Compound Name | 2-(2,4-difluorophenyl)ethyl-dihydroxy-methoxysilane |
|---|---|
| PubChem CID | 90170768 |
| Molecular Formula | C9H12F2O3Si |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-(2,4-difluorophenyl)ethyl-dihydroxy-methoxysilane |
| SMILES | CO[Si](O)(O)CCc1ccc(F)cc1F |
| InChI | InChI=1S/C9H12F2O3Si/c1-14-15(12,13)5-4-7-2-3-8(10)6-9(7)11/h2-3,6,12-13H,4-5H2,1H3 |
| InChIKey | ZRRJBAXZXJARMN-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|