C8H10F2O3Si — CID 90175103
(2,4-difluorophenyl)-hydroxy-dimethoxysilane (PubChem CID 90175103) has the molecular formula C8H10F2O3Si and a molecular weight of 220.25 g/mol. Its IUPAC name is (2,4-difluorophenyl)-hydroxy-dimethoxysilane.
| Compound Name | (2,4-difluorophenyl)-hydroxy-dimethoxysilane |
|---|---|
| PubChem CID | 90175103 |
| Molecular Formula | C8H10F2O3Si |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | (2,4-difluorophenyl)-hydroxy-dimethoxysilane |
| SMILES | CO[Si](O)(OC)c1ccc(F)cc1F |
| InChI | InChI=1S/C8H10F2O3Si/c1-12-14(11,13-2)8-4-3-6(9)5-7(8)10/h3-5,11H,1-2H3 |
| InChIKey | SRRWGKYLXXCTFO-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|