C10H14F2O3Si — CID 90171252
(2,4-difluorophenyl)-diethoxy-hydroxysilane (PubChem CID 90171252) has the molecular formula C10H14F2O3Si and a molecular weight of 248.30 g/mol. Its IUPAC name is (2,4-difluorophenyl)-diethoxy-hydroxysilane.
| Compound Name | (2,4-difluorophenyl)-diethoxy-hydroxysilane |
|---|---|
| PubChem CID | 90171252 |
| Molecular Formula | C10H14F2O3Si |
| Molecular Weight | 248.30 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (2,4-difluorophenyl)-diethoxy-hydroxysilane |
| SMILES | CCO[Si](O)(OCC)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H14F2O3Si/c1-3-14-16(13,15-4-2)10-6-5-8(11)7-9(10)12/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | GQXARFMXGABBCP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|