C11H15F3O3Si — CID 90171682
diethoxy-methoxy-(2,4,6-trifluorophenyl)silane (PubChem CID 90171682) has the molecular formula C11H15F3O3Si and a molecular weight of 280.32 g/mol. Its IUPAC name is diethoxy-methoxy-(2,4,6-trifluorophenyl)silane.
| Compound Name | diethoxy-methoxy-(2,4,6-trifluorophenyl)silane |
|---|---|
| PubChem CID | 90171682 |
| Molecular Formula | C11H15F3O3Si |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | diethoxy-methoxy-(2,4,6-trifluorophenyl)silane |
| SMILES | CCO[Si](OC)(OCC)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H15F3O3Si/c1-4-16-18(15-3,17-5-2)11-9(13)6-8(12)7-10(11)14/h6-7H,4-5H2,1-3H3 |
| InChIKey | KHHYJWLEPCWWGF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|