About triethoxy(phenyl)silane
triethoxy(phenyl)silane (PubChem CID 13075) has the molecular formula C12H20O3Si
and a molecular weight of 240.37 g/mol. Its IUPAC name is triethoxy(phenyl)silane.
Molecular Properties
| Compound Name | triethoxy(phenyl)silane |
| PubChem CID | 13075 |
| Molecular Formula | C12H20O3Si |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | triethoxy(phenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccccc1 |
| InChI | InChI=1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3 |
| InChIKey | JCVQKRGIASEUKR-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethoxy(phenyl)silane?
The IUPAC name of triethoxy(phenyl)silane (CID 13075) is triethoxy(phenyl)silane.
What is the SMILES notation for triethoxy(phenyl)silane?
The canonical SMILES for triethoxy(phenyl)silane is CCO[Si](OCC)(OCC)c1ccccc1.
What is the InChIKey of triethoxy(phenyl)silane?
The InChIKey is JCVQKRGIASEUKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3Si/c1-4-13-16(14-5-2,15-6-3)12-10-8-7-9-11-12/h7-11H,4-6H2,1-3H3.
What are the key properties of triethoxy(phenyl)silane?
triethoxy(phenyl)silane has a molecular weight of 240.37 g/mol, XLogP of 1.94, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triethoxy(phenyl)silane is sourced from PubChem (CID 13075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).