C10H13F3OSi — CID 14917442
dimethyl-phenyl-(2,2,2-trifluoroethoxy)silane (PubChem CID 14917442) has the molecular formula C10H13F3OSi and a molecular weight of 234.29 g/mol. Its IUPAC name is dimethyl-phenyl-(2,2,2-trifluoroethoxy)silane.
| Compound Name | dimethyl-phenyl-(2,2,2-trifluoroethoxy)silane |
|---|---|
| PubChem CID | 14917442 |
| Molecular Formula | C10H13F3OSi |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | dimethyl-phenyl-(2,2,2-trifluoroethoxy)silane |
| SMILES | C[Si](C)(OCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H13F3OSi/c1-15(2,14-8-10(11,12)13)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | PHYUNAFANIQZNW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|