C16H26F2O3Si — CID 90171825
6-(2,4-difluorophenyl)hexyl-ethoxy-dimethoxysilane (PubChem CID 90171825) has the molecular formula C16H26F2O3Si and a molecular weight of 332.46 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)hexyl-ethoxy-dimethoxysilane.
| Compound Name | 6-(2,4-difluorophenyl)hexyl-ethoxy-dimethoxysilane |
|---|---|
| PubChem CID | 90171825 |
| Molecular Formula | C16H26F2O3Si |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 6-(2,4-difluorophenyl)hexyl-ethoxy-dimethoxysilane |
| SMILES | CCO[Si](CCCCCCc1ccc(F)cc1F)(OC)OC |
| InChI | InChI=1S/C16H26F2O3Si/c1-4-21-22(19-2,20-3)12-8-6-5-7-9-14-10-11-15(17)13-16(14)18/h10-11,13H,4-9,12H2,1-3H3 |
| InChIKey | VPTYAHLJSMZXHZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|