C14H21F3O3Si — CID 90172834
ethoxy-dimethoxy-[4-(2,4,6-trifluorophenyl)butyl]silane (PubChem CID 90172834) has the molecular formula C14H21F3O3Si and a molecular weight of 322.40 g/mol. Its IUPAC name is ethoxy-dimethoxy-[4-(2,4,6-trifluorophenyl)butyl]silane.
| Compound Name | ethoxy-dimethoxy-[4-(2,4,6-trifluorophenyl)butyl]silane |
|---|---|
| PubChem CID | 90172834 |
| Molecular Formula | C14H21F3O3Si |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | ethoxy-dimethoxy-[4-(2,4,6-trifluorophenyl)butyl]silane |
| SMILES | CCO[Si](CCCCc1c(F)cc(F)cc1F)(OC)OC |
| InChI | InChI=1S/C14H21F3O3Si/c1-4-20-21(18-2,19-3)8-6-5-7-12-13(16)9-11(15)10-14(12)17/h9-10H,4-8H2,1-3H3 |
| InChIKey | MCVXCUVDNZUEBK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|