C13H17F3 — CID 59545279
1,3,5-trifluoro-2-heptylbenzene (PubChem CID 59545279) has the molecular formula C13H17F3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 1,3,5-trifluoro-2-heptylbenzene.
| Compound Name | 1,3,5-trifluoro-2-heptylbenzene |
|---|---|
| PubChem CID | 59545279 |
| Molecular Formula | C13H17F3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1,3,5-trifluoro-2-heptylbenzene |
| SMILES | CCCCCCCc1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H17F3/c1-2-3-4-5-6-7-11-12(15)8-10(14)9-13(11)16/h8-9H,2-7H2,1H3 |
| InChIKey | AHRXBGTWBAGUFG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|