C21H33F3O3 — CID 150487734
1-(2,4,6-trifluorophenyl)tetradecan-5-yloxymethanediol (PubChem CID 150487734) has the molecular formula C21H33F3O3 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-(2,4,6-trifluorophenyl)tetradecan-5-yloxymethanediol.
| Compound Name | 1-(2,4,6-trifluorophenyl)tetradecan-5-yloxymethanediol |
|---|---|
| PubChem CID | 150487734 |
| Molecular Formula | C21H33F3O3 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 1-(2,4,6-trifluorophenyl)tetradecan-5-yloxymethanediol |
| SMILES | CCCCCCCCCC(CCCCc1c(F)cc(F)cc1F)OC(O)O |
| InChI | InChI=1S/C21H33F3O3/c1-2-3-4-5-6-7-8-11-17(27-21(25)26)12-9-10-13-18-19(23)14-16(22)15-20(18)24/h14-15,17,21,25-26H,2-13H2,1H3 |
| InChIKey | HVDKHXOMUJEUAQ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|