C20H31F3O — CID 151293119
1,3,5-trifluoro-2-[2-(2-methoxypropan-2-yl)decyl]benzene (PubChem CID 151293119) has the molecular formula C20H31F3O and a molecular weight of 344.46 g/mol. Its IUPAC name is 1,3,5-trifluoro-2-[2-(2-methoxypropan-2-yl)decyl]benzene.
| Compound Name | 1,3,5-trifluoro-2-[2-(2-methoxypropan-2-yl)decyl]benzene |
|---|---|
| PubChem CID | 151293119 |
| Molecular Formula | C20H31F3O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 1,3,5-trifluoro-2-[2-(2-methoxypropan-2-yl)decyl]benzene |
| SMILES | CCCCCCCCC(Cc1c(F)cc(F)cc1F)C(C)(C)OC |
| InChI | InChI=1S/C20H31F3O/c1-5-6-7-8-9-10-11-15(20(2,3)24-4)12-17-18(22)13-16(21)14-19(17)23/h13-15H,5-12H2,1-4H3 |
| InChIKey | OAVOKSWGIAXMJE-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|