C21H35FO — CID 150178720
1-fluoro-3-[3-(2-methoxypropan-2-yl)undecyl]benzene (PubChem CID 150178720) has the molecular formula C21H35FO and a molecular weight of 322.51 g/mol. Its IUPAC name is 1-fluoro-3-[3-(2-methoxypropan-2-yl)undecyl]benzene.
| Compound Name | 1-fluoro-3-[3-(2-methoxypropan-2-yl)undecyl]benzene |
|---|---|
| PubChem CID | 150178720 |
| Molecular Formula | C21H35FO |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | 1-fluoro-3-[3-(2-methoxypropan-2-yl)undecyl]benzene |
| SMILES | CCCCCCCCC(CCc1cccc(F)c1)C(C)(C)OC |
| InChI | InChI=1S/C21H35FO/c1-5-6-7-8-9-10-13-19(21(2,3)23-4)16-15-18-12-11-14-20(22)17-18/h11-12,14,17,19H,5-10,13,15-16H2,1-4H3 |
| InChIKey | FKYRRYYRTZLBPQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|