C20H33FO3 — CID 150948230
1-[2-(1,1-dimethoxydecoxy)ethyl]-3-fluorobenzene (PubChem CID 150948230) has the molecular formula C20H33FO3 and a molecular weight of 340.48 g/mol. Its IUPAC name is 1-[2-(1,1-dimethoxydecoxy)ethyl]-3-fluorobenzene.
| Compound Name | 1-[2-(1,1-dimethoxydecoxy)ethyl]-3-fluorobenzene |
|---|---|
| PubChem CID | 150948230 |
| Molecular Formula | C20H33FO3 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-[2-(1,1-dimethoxydecoxy)ethyl]-3-fluorobenzene |
| SMILES | CCCCCCCCCC(OC)(OC)OCCc1cccc(F)c1 |
| InChI | InChI=1S/C20H33FO3/c1-4-5-6-7-8-9-10-15-20(22-2,23-3)24-16-14-18-12-11-13-19(21)17-18/h11-13,17H,4-10,14-16H2,1-3H3 |
| InChIKey | LJNIBAISWQDABZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|