C27H47FO3 — CID 172707034
1-fluoro-3-[3-(tripropoxymethyl)undecyl]benzene (PubChem CID 172707034) has the molecular formula C27H47FO3 and a molecular weight of 438.67 g/mol. Its IUPAC name is 1-fluoro-3-[3-(tripropoxymethyl)undecyl]benzene.
| Compound Name | 1-fluoro-3-[3-(tripropoxymethyl)undecyl]benzene |
|---|---|
| PubChem CID | 172707034 |
| Molecular Formula | C27H47FO3 |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 1-fluoro-3-[3-(tripropoxymethyl)undecyl]benzene |
| SMILES | CCCCCCCCC(CCc1cccc(F)c1)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C27H47FO3/c1-5-9-10-11-12-13-16-25(19-18-24-15-14-17-26(28)23-24)27(29-20-6-2,30-21-7-3)31-22-8-4/h14-15,17,23,25H,5-13,16,18-22H2,1-4H3 |
| InChIKey | DSNGCGBWHOBDMD-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|