C35H59F5O3 — CID 172758790
1,2,3,4,5-pentafluoro-6-[11-(tripropoxymethyl)nonadecyl]benzene (PubChem CID 172758790) has the molecular formula C35H59F5O3 and a molecular weight of 622.84 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[11-(tripropoxymethyl)nonadecyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[11-(tripropoxymethyl)nonadecyl]benzene |
|---|---|
| PubChem CID | 172758790 |
| Molecular Formula | C35H59F5O3 |
| Molecular Weight | 622.84 g/mol |
| Exact Mass | 622.44 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[11-(tripropoxymethyl)nonadecyl]benzene |
| SMILES | CCCCCCCCC(CCCCCCCCCCc1c(F)c(F)c(F)c(F)c1F)C(OCCC)(OCCC)OCCC |
| InChI | InChI=1S/C35H59F5O3/c1-5-9-10-11-16-19-22-28(35(41-25-6-2,42-26-7-3)43-27-8-4)23-20-17-14-12-13-15-18-21-24-29-30(36)32(38)34(40)33(39)31(29)37/h28H,5-27H2,1-4H3 |
| InChIKey | LJYNGWDMIVBCKG-UHFFFAOYSA-N |
| XLogP | 11.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.84 |
| LogP ≤ 5 | 11.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|