C30H49F5O3 — CID 150317505
1,1-diethoxy-2-octyl-12-(2,3,4,5,6-pentafluorophenyl)dodecan-1-ol (PubChem CID 150317505) has the molecular formula C30H49F5O3 and a molecular weight of 552.71 g/mol. Its IUPAC name is 1,1-diethoxy-2-octyl-12-(2,3,4,5,6-pentafluorophenyl)dodecan-1-ol.
| Compound Name | 1,1-diethoxy-2-octyl-12-(2,3,4,5,6-pentafluorophenyl)dodecan-1-ol |
|---|---|
| PubChem CID | 150317505 |
| Molecular Formula | C30H49F5O3 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | 1,1-diethoxy-2-octyl-12-(2,3,4,5,6-pentafluorophenyl)dodecan-1-ol |
| SMILES | CCCCCCCCC(CCCCCCCCCCc1c(F)c(F)c(F)c(F)c1F)C(O)(OCC)OCC |
| InChI | InChI=1S/C30H49F5O3/c1-4-7-8-9-14-17-20-23(30(36,37-5-2)38-6-3)21-18-15-12-10-11-13-16-19-22-24-25(31)27(33)29(35)28(34)26(24)32/h23,36H,4-22H2,1-3H3 |
| InChIKey | GMXOUSLYGMTDSP-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|