C27H43F5O3 — CID 151900182
2-[5-(2,3,4,5,6-pentafluorophenyl)pentyl]-1,1-di(propan-2-yloxy)decan-1-ol (PubChem CID 151900182) has the molecular formula C27H43F5O3 and a molecular weight of 510.63 g/mol. Its IUPAC name is 2-[5-(2,3,4,5,6-pentafluorophenyl)pentyl]-1,1-di(propan-2-yloxy)decan-1-ol.
| Compound Name | 2-[5-(2,3,4,5,6-pentafluorophenyl)pentyl]-1,1-di(propan-2-yloxy)decan-1-ol |
|---|---|
| PubChem CID | 151900182 |
| Molecular Formula | C27H43F5O3 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.31 |
| IUPAC Name | 2-[5-(2,3,4,5,6-pentafluorophenyl)pentyl]-1,1-di(propan-2-yloxy)decan-1-ol |
| SMILES | CCCCCCCCC(CCCCCc1c(F)c(F)c(F)c(F)c1F)C(O)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C27H43F5O3/c1-6-7-8-9-10-12-15-20(27(33,34-18(2)3)35-19(4)5)16-13-11-14-17-21-22(28)24(30)26(32)25(31)23(21)29/h18-20,33H,6-17H2,1-5H3 |
| InChIKey | SSPKGQMGKXQLJA-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|