C27H42F5NO5 — CID 150021143
(2,3,4,5,6-pentafluorophenyl) N-[2-[tri(propan-2-yloxy)methyl]decyl]carbamate (PubChem CID 150021143) has the molecular formula C27H42F5NO5 and a molecular weight of 555.63 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) N-[2-[tri(propan-2-yloxy)methyl]decyl]carbamate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) N-[2-[tri(propan-2-yloxy)methyl]decyl]carbamate |
|---|---|
| PubChem CID | 150021143 |
| Molecular Formula | C27H42F5NO5 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.30 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) N-[2-[tri(propan-2-yloxy)methyl]decyl]carbamate |
| SMILES | CCCCCCCCC(CNC(=O)Oc1c(F)c(F)c(F)c(F)c1F)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C27H42F5NO5/c1-8-9-10-11-12-13-14-19(27(36-16(2)3,37-17(4)5)38-18(6)7)15-33-26(34)35-25-23(31)21(29)20(28)22(30)24(25)32/h16-19H,8-15H2,1-7H3,(H,33,34) |
| InChIKey | DFGWJUMZYPUFSU-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|