C21H41F3O3 — CID 151669303
1,1,1-trifluoro-3-[tri(propan-2-yloxy)methyl]undecane (PubChem CID 151669303) has the molecular formula C21H41F3O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-[tri(propan-2-yloxy)methyl]undecane.
| Compound Name | 1,1,1-trifluoro-3-[tri(propan-2-yloxy)methyl]undecane |
|---|---|
| PubChem CID | 151669303 |
| Molecular Formula | C21H41F3O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.30 |
| IUPAC Name | 1,1,1-trifluoro-3-[tri(propan-2-yloxy)methyl]undecane |
| SMILES | CCCCCCCCC(CC(F)(F)F)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C21H41F3O3/c1-8-9-10-11-12-13-14-19(15-20(22,23)24)21(25-16(2)3,26-17(4)5)27-18(6)7/h16-19H,8-15H2,1-7H3 |
| InChIKey | QYEPGLZZCPMREQ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|