C28H47F3O3 — CID 150856702
1-(trifluoromethyl)-4-[3-[tri(propan-2-yloxy)methyl]undecyl]benzene (PubChem CID 150856702) has the molecular formula C28H47F3O3 and a molecular weight of 488.68 g/mol. Its IUPAC name is 1-(trifluoromethyl)-4-[3-[tri(propan-2-yloxy)methyl]undecyl]benzene.
| Compound Name | 1-(trifluoromethyl)-4-[3-[tri(propan-2-yloxy)methyl]undecyl]benzene |
|---|---|
| PubChem CID | 150856702 |
| Molecular Formula | C28H47F3O3 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 1-(trifluoromethyl)-4-[3-[tri(propan-2-yloxy)methyl]undecyl]benzene |
| SMILES | CCCCCCCCC(CCc1ccc(C(F)(F)F)cc1)C(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C28H47F3O3/c1-8-9-10-11-12-13-14-26(20-17-24-15-18-25(19-16-24)27(29,30)31)28(32-21(2)3,33-22(4)5)34-23(6)7/h15-16,18-19,21-23,26H,8-14,17,20H2,1-7H3 |
| InChIKey | KRDQVCXBKCHJAO-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|